C8H17ClN2O3S — CID 63665762
3-(chloromethylsulfonylamino)-N,N-diethylpropanamide (PubChem CID 63665762) has the molecular formula C8H17ClN2O3S and a molecular weight of 256.75 g/mol. Its IUPAC name is 3-(chloromethylsulfonylamino)-N,N-diethylpropanamide.
| Compound Name | 3-(chloromethylsulfonylamino)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 63665762 |
| Molecular Formula | C8H17ClN2O3S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(chloromethylsulfonylamino)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNS(=O)(=O)CCl |
| InChI | InChI=1S/C8H17ClN2O3S/c1-3-11(4-2)8(12)5-6-10-15(13,14)7-9/h10H,3-7H2,1-2H3 |
| InChIKey | RHQUUUXSAXVGLI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|