C14H19ClN4O2 — CID 96536495
4-[(2R)-1-amino-1-oxopropan-2-yl]-N-(2-chlorophenyl)piperazine-1-carboxamide (PubChem CID 96536495) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 4-[(2R)-1-amino-1-oxopropan-2-yl]-N-(2-chlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2R)-1-amino-1-oxopropan-2-yl]-N-(2-chlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 96536495 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-[(2R)-1-amino-1-oxopropan-2-yl]-N-(2-chlorophenyl)piperazine-1-carboxamide |
| SMILES | C[C@H](C(N)=O)N1CCN(C(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H19ClN4O2/c1-10(13(16)20)18-6-8-19(9-7-18)14(21)17-12-5-3-2-4-11(12)15/h2-5,10H,6-9H2,1H3,(H2,16,20)(H,17,21)/t10-/m1/s1 |
| InChIKey | VTSUTDICGSTYRH-SNVBAGLBSA-N |
| XLogP | 1.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |