C24H27N3O3S — CID 96539798
(3aS,7aS)-2-[(2R)-1-[3-(1,3-benzothiazol-2-yl)azetidin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 96539798) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2R)-1-[3-(1,3-benzothiazol-2-yl)azetidin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(2R)-1-[3-(1,3-benzothiazol-2-yl)azetidin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 96539798 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (3aS,7aS)-2-[(2R)-1-[3-(1,3-benzothiazol-2-yl)azetidin-1-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)C[C@H](C(=O)N1CC(c2nc3ccccc3s2)C1)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C24H27N3O3S/c1-14(2)11-19(27-22(28)16-7-3-4-8-17(16)23(27)29)24(30)26-12-15(13-26)21-25-18-9-5-6-10-20(18)31-21/h3-6,9-10,14-17,19H,7-8,11-13H2,1-2H3/t16-,17-,19+/m0/s1 |
| InChIKey | ZYMNYBJCQFRJBT-JENIJYKNSA-N |
| XLogP | 3.59 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|