C11H14BrN3O3S — CID 96542782
(3R)-N-(4-bromophenyl)-3-sulfamoylpyrrolidine-1-carboxamide (PubChem CID 96542782) has the molecular formula C11H14BrN3O3S and a molecular weight of 348.22 g/mol. Its IUPAC name is (3R)-N-(4-bromophenyl)-3-sulfamoylpyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-(4-bromophenyl)-3-sulfamoylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 96542782 |
| Molecular Formula | C11H14BrN3O3S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | (3R)-N-(4-bromophenyl)-3-sulfamoylpyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)[C@@H]1CCN(C(=O)Nc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C11H14BrN3O3S/c12-8-1-3-9(4-2-8)14-11(16)15-6-5-10(7-15)19(13,17)18/h1-4,10H,5-7H2,(H,14,16)(H2,13,17,18)/t10-/m1/s1 |
| InChIKey | YZUHEMKQHWRIHD-SNVBAGLBSA-N |
| XLogP | 1.34 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |