About (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide
(3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide (PubChem CID 96542793) has the molecular formula C15H18N4O4S
and a molecular weight of 350.40 g/mol. Its IUPAC name is (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide |
| PubChem CID | 96542793 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)[C@H]1CCN(C(=O)Nc2ccc3oc(C4CC4)nc3c2)C1 |
| InChI | InChI=1S/C15H18N4O4S/c16-24(21,22)11-5-6-19(8-11)15(20)17-10-3-4-13-12(7-10)18-14(23-13)9-1-2-9/h3-4,7,9,11H,1-2,5-6,8H2,(H,17,20)(H2,16,21,22)/t11-/m0/s1 |
| InChIKey | LWVWEXVBVPKMIE-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide?
The IUPAC name of (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide (CID 96542793) is (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide.
What is the SMILES notation for (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide?
The canonical SMILES for (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide is NS(=O)(=O)[C@H]1CCN(C(=O)Nc2ccc3oc(C4CC4)nc3c2)C1.
What is the InChIKey of (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide?
The InChIKey is LWVWEXVBVPKMIE-NSHDSACASA-N. The full InChI is InChI=1S/C15H18N4O4S/c16-24(21,22)11-5-6-19(8-11)15(20)17-10-3-4-13-12(7-10)18-14(23-13)9-1-2-9/h3-4,7,9,11H,1-2,5-6,8H2,(H,17,20)(H2,16,21,22)/t11-/m0/s1.
What are the key properties of (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide?
(3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide has a molecular weight of 350.40 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-3-sulfamoylpyrrolidine-1-carboxamide is sourced from PubChem (CID 96542793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).