C19H25N3O2S — CID 96543615
trans-(1R,2R)-N-[3-[(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 96543615) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is trans-(1R,2R)-N-[3-[(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[3-[(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 96543615 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | trans-(1R,2R)-N-[3-[(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)NCCC(=O)Nc1sc2c(c1C#N)CCCCCC2 |
| InChI | InChI=1S/C19H25N3O2S/c1-12-10-14(12)18(24)21-9-8-17(23)22-19-15(11-20)13-6-4-2-3-5-7-16(13)25-19/h12,14H,2-10H2,1H3,(H,21,24)(H,22,23)/t12-,14-/m1/s1 |
| InChIKey | ULSQQOOJSDZBEA-TZMCWYRMSA-N |
| XLogP | 3.38 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |