C14H15F3N2O2S — CID 96562519
1-methyl-N-[2-[(R)-methylsulfinyl]ethyl]-5-(trifluoromethyl)indole-2-carboxamide (PubChem CID 96562519) has the molecular formula C14H15F3N2O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-methyl-N-[2-[(R)-methylsulfinyl]ethyl]-5-(trifluoromethyl)indole-2-carboxamide.
| Compound Name | 1-methyl-N-[2-[(R)-methylsulfinyl]ethyl]-5-(trifluoromethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 96562519 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-methyl-N-[2-[(R)-methylsulfinyl]ethyl]-5-(trifluoromethyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCC[S@@](C)=O)cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H15F3N2O2S/c1-19-11-4-3-10(14(15,16)17)7-9(11)8-12(19)13(20)18-5-6-22(2)21/h3-4,7-8H,5-6H2,1-2H3,(H,18,20)/t22-/m1/s1 |
| InChIKey | MFENSKWLVYMUCO-JOCHJYFZSA-N |
| XLogP | 2.31 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |