C16H19F3N2O3 — CID 110024013
N-[3-(2-hydroxyethoxy)propyl]-1-methyl-5-(trifluoromethyl)indole-2-carboxamide (PubChem CID 110024013) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[3-(2-hydroxyethoxy)propyl]-1-methyl-5-(trifluoromethyl)indole-2-carboxamide.
| Compound Name | N-[3-(2-hydroxyethoxy)propyl]-1-methyl-5-(trifluoromethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110024013 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[3-(2-hydroxyethoxy)propyl]-1-methyl-5-(trifluoromethyl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCCCOCCO)cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H19F3N2O3/c1-21-13-4-3-12(16(17,18)19)9-11(13)10-14(21)15(23)20-5-2-7-24-8-6-22/h3-4,9-10,22H,2,5-8H2,1H3,(H,20,23) |
| InChIKey | ZQHSZCCSNIABJR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|