C21H27NO4S — CID 96564834
N-[(3S)-1-(benzenesulfonyl)pentan-3-yl]-2-(2,6-dimethylphenoxy)acetamide (PubChem CID 96564834) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(3S)-1-(benzenesulfonyl)pentan-3-yl]-2-(2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[(3S)-1-(benzenesulfonyl)pentan-3-yl]-2-(2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 96564834 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[(3S)-1-(benzenesulfonyl)pentan-3-yl]-2-(2,6-dimethylphenoxy)acetamide |
| SMILES | CC[C@@H](CCS(=O)(=O)c1ccccc1)NC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C21H27NO4S/c1-4-18(13-14-27(24,25)19-11-6-5-7-12-19)22-20(23)15-26-21-16(2)9-8-10-17(21)3/h5-12,18H,4,13-15H2,1-3H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | WQXRXQJTVZUHNN-SFHVURJKSA-N |
| XLogP | 3.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |