C19H23NO3S — CID 96571573
N-[(3R)-1-(benzenesulfonyl)pentan-3-yl]-4-methylbenzamide (PubChem CID 96571573) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is N-[(3R)-1-(benzenesulfonyl)pentan-3-yl]-4-methylbenzamide.
| Compound Name | N-[(3R)-1-(benzenesulfonyl)pentan-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 96571573 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[(3R)-1-(benzenesulfonyl)pentan-3-yl]-4-methylbenzamide |
| SMILES | CC[C@H](CCS(=O)(=O)c1ccccc1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-3-17(20-19(21)16-11-9-15(2)10-12-16)13-14-24(22,23)18-7-5-4-6-8-18/h4-12,17H,3,13-14H2,1-2H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | ZKEMNGVPZTVILF-QGZVFWFLSA-N |
| XLogP | 3.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |