C16H27N3O2S — CID 96573189
(4R)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 96573189) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is (4R)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | (4R)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 96573189 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4R)-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | Cc1[nH]cnc1CSCCN[C@@H]1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H27N3O2S/c1-13-15(19-12-18-13)11-22-9-5-17-14-2-6-21-16(10-14)3-7-20-8-4-16/h12,14,17H,2-11H2,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | CEGNGGFZHHUILN-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|