C16H20N4O3 — CID 96575416
(5R)-7-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2,7-diazaspiro[4.4]nonane-1,3-dione (PubChem CID 96575416) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (5R)-7-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2,7-diazaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5R)-7-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2,7-diazaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 96575416 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (5R)-7-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2,7-diazaspiro[4.4]nonane-1,3-dione |
| SMILES | Cn1nc2c(c1C(=O)N1CC[C@@]3(CC(=O)NC3=O)C1)CCCC2 |
| InChI | InChI=1S/C16H20N4O3/c1-19-13(10-4-2-3-5-11(10)18-19)14(22)20-7-6-16(9-20)8-12(21)17-15(16)23/h2-9H2,1H3,(H,17,21,23)/t16-/m1/s1 |
| InChIKey | GXHFVCXQJSDDQI-MRXNPFEDSA-N |
| XLogP | 0.18 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|