C18H26N4O2 — CID 96576671
(4R)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 96576671) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (4R)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | (4R)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 96576671 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (4R)-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | c1ccn2c(CCCN[C@@H]3CCOC4(CCOCC4)C3)nnc2c1 |
| InChI | InChI=1S/C18H26N4O2/c1-2-10-22-16(4-1)20-21-17(22)5-3-9-19-15-6-11-24-18(14-15)7-12-23-13-8-18/h1-2,4,10,15,19H,3,5-9,11-14H2/t15-/m1/s1 |
| InChIKey | UCYVOTNCFVBFJC-OAHLLOKOSA-N |
| XLogP | 1.98 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|