C20H25FN2O2S — CID 96579788
N-[(3S)-1-[(2-fluoro-4-methoxyphenyl)methyl]azepan-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 96579788) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[(3S)-1-[(2-fluoro-4-methoxyphenyl)methyl]azepan-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3S)-1-[(2-fluoro-4-methoxyphenyl)methyl]azepan-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 96579788 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(3S)-1-[(2-fluoro-4-methoxyphenyl)methyl]azepan-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(CN2CCCC[C@H](NC(=O)Cc3cccs3)C2)c(F)c1 |
| InChI | InChI=1S/C20H25FN2O2S/c1-25-17-8-7-15(19(21)11-17)13-23-9-3-2-5-16(14-23)22-20(24)12-18-6-4-10-26-18/h4,6-8,10-11,16H,2-3,5,9,12-14H2,1H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | QMUOOEWVRMICKN-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |