C9H7ClN2S — CID 96589915
2-(2-chlorophenyl)-1,3-thiazol-5-amine (PubChem CID 96589915) has the molecular formula C9H7ClN2S and a molecular weight of 210.69 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-(2-chlorophenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 96589915 |
| Molecular Formula | C9H7ClN2S |
| Molecular Weight | 210.69 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 2-(2-chlorophenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C9H7ClN2S/c10-7-4-2-1-3-6(7)9-12-5-8(11)13-9/h1-5H,11H2 |
| InChIKey | RQMWMAGCIDCHFT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |