C11H7Cl2NO — CID 96591689
4-(3,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde (PubChem CID 96591689) has the molecular formula C11H7Cl2NO and a molecular weight of 240.09 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde.
| Compound Name | 4-(3,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 96591689 |
| Molecular Formula | C11H7Cl2NO |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1cc(-c2ccc(Cl)c(Cl)c2)c[nH]1 |
| InChI | InChI=1S/C11H7Cl2NO/c12-10-2-1-7(4-11(10)13)8-3-9(6-15)14-5-8/h1-6,14H |
| InChIKey | HIJQYJBFWPNFLD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|