About 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid
1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid (PubChem CID 96602541) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid |
| PubChem CID | 96602541 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid |
| SMILES | COCc1cc(C2(C(=O)O)CCC2)sn1 |
| InChI | InChI=1S/C10H13NO3S/c1-14-6-7-5-8(15-11-7)10(9(12)13)3-2-4-10/h5H,2-4,6H2,1H3,(H,12,13) |
| InChIKey | SMCDEBRLMHPSKY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid (CID 96602541) is 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid is COCc1cc(C2(C(=O)O)CCC2)sn1.
What is the InChIKey of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid?
The InChIKey is SMCDEBRLMHPSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-14-6-7-5-8(15-11-7)10(9(12)13)3-2-4-10/h5H,2-4,6H2,1H3,(H,12,13).
What are the key properties of 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid?
1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid has a molecular weight of 227.28 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(methoxymethyl)-1,2-thiazol-5-yl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 96602541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).