C11H12ClNO2 — CID 96603656
3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carboxylic acid (PubChem CID 96603656) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carboxylic acid.
| Compound Name | 3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 96603656 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-chloro-1-methyl-5,6,7,8-tetrahydroisoquinoline-4-carboxylic acid |
| SMILES | Cc1nc(Cl)c(C(=O)O)c2c1CCCC2 |
| InChI | InChI=1S/C11H12ClNO2/c1-6-7-4-2-3-5-8(7)9(11(14)15)10(12)13-6/h2-5H2,1H3,(H,14,15) |
| InChIKey | QZVHXXALWVNVKR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|