C12H20N2S — CID 96604480
[(2S,3R)-1-ethyl-2-thiophen-2-ylpiperidin-3-yl]methanamine (PubChem CID 96604480) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is [(2S,3R)-1-ethyl-2-thiophen-2-ylpiperidin-3-yl]methanamine.
| Compound Name | [(2S,3R)-1-ethyl-2-thiophen-2-ylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 96604480 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | [(2S,3R)-1-ethyl-2-thiophen-2-ylpiperidin-3-yl]methanamine |
| SMILES | CCN1CCC[C@H](CN)[C@H]1c1cccs1 |
| InChI | InChI=1S/C12H20N2S/c1-2-14-7-3-5-10(9-13)12(14)11-6-4-8-15-11/h4,6,8,10,12H,2-3,5,7,9,13H2,1H3/t10-,12+/m1/s1 |
| InChIKey | DGVHVNVWJNMUDL-PWSUYJOCSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |