C11H16N4 — CID 96618338
2-[4-[(3-methyl-1H-pyrrol-2-yl)methyl]-1H-pyrazol-5-yl]ethanamine (PubChem CID 96618338) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-[4-[(3-methyl-1H-pyrrol-2-yl)methyl]-1H-pyrazol-5-yl]ethanamine.
| Compound Name | 2-[4-[(3-methyl-1H-pyrrol-2-yl)methyl]-1H-pyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 96618338 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[4-[(3-methyl-1H-pyrrol-2-yl)methyl]-1H-pyrazol-5-yl]ethanamine |
| SMILES | Cc1cc[nH]c1Cc1cn[nH]c1CCN |
| InChI | InChI=1S/C11H16N4/c1-8-3-5-13-11(8)6-9-7-14-15-10(9)2-4-12/h3,5,7,13H,2,4,6,12H2,1H3,(H,14,15) |
| InChIKey | WJSNTDSRBSOQDE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |