C10H13N3O — CID 96624702
2-[4-(furan-2-ylmethyl)-1H-pyrazol-5-yl]ethanamine (PubChem CID 96624702) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[4-(furan-2-ylmethyl)-1H-pyrazol-5-yl]ethanamine.
| Compound Name | 2-[4-(furan-2-ylmethyl)-1H-pyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 96624702 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[4-(furan-2-ylmethyl)-1H-pyrazol-5-yl]ethanamine |
| SMILES | NCCc1[nH]ncc1Cc1ccco1 |
| InChI | InChI=1S/C10H13N3O/c11-4-3-10-8(7-12-13-10)6-9-2-1-5-14-9/h1-2,5,7H,3-4,6,11H2,(H,12,13) |
| InChIKey | KNNHAWBLJWEARP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |