C9H10N2O2 — CID 82468239
2-[2-(furan-2-yl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 82468239) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 2-[2-(furan-2-yl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82468239 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-[2-(furan-2-yl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(-c2ccco2)o1 |
| InChI | InChI=1S/C9H10N2O2/c10-4-3-7-6-11-9(13-7)8-2-1-5-12-8/h1-2,5-6H,3-4,10H2 |
| InChIKey | DHOAAERGPJLWJE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |