C14H14N4O3 — CID 63103060
4-amino-N,N-bis(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 63103060) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-amino-N,N-bis(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N,N-bis(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63103060 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-N,N-bis(furan-2-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cn[nH]c1C(=O)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C14H14N4O3/c15-12-7-16-17-13(12)14(19)18(8-10-3-1-5-20-10)9-11-4-2-6-21-11/h1-7H,8-9,15H2,(H,16,17) |
| InChIKey | ZCDOKHRLNRODOR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |