C10H11N5O — CID 86744557
4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen (PubChem CID 86744557) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen.
| Compound Name | 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen |
|---|---|
| PubChem CID | 86744557 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen |
| SMILES | N#N.Nc1nccc(Cc2ccco2)c1N |
| InChI | InChI=1S/C10H11N3O.N2/c11-9-7(3-4-13-10(9)12)6-8-2-1-5-14-8;1-2/h1-5H,6,11H2,(H2,12,13); |
| InChIKey | RWFNBAJLHCQSGS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|