4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen

C10H11N5O — CID 86744557

IUPAC4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen
SMILESN#N.Nc1nccc(Cc2ccco2)c1N
InChIInChI=1S/C10H11N3O.N2/c11-9-7(3-4-13-10(9)12)6-8-2-1-5-14-8;1-2/h1-5H,6,11H2,(H2,12,13);
InChIKeyRWFNBAJLHCQSGS-UHFFFAOYSA-N
MW217.23 g/mol
LogP1.46
Rot. Bonds2

About 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen

4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen (PubChem CID 86744557) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen.

Molecular Properties

Compound Name4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen
PubChem CID86744557
Molecular FormulaC10H11N5O
Molecular Weight217.23 g/mol
Exact Mass217.10
IUPAC Name4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen
SMILESN#N.Nc1nccc(Cc2ccco2)c1N
InChIInChI=1S/C10H11N3O.N2/c11-9-7(3-4-13-10(9)12)6-8-2-1-5-14-8;1-2/h1-5H,6,11H2,(H2,12,13);
InChIKeyRWFNBAJLHCQSGS-UHFFFAOYSA-N
XLogP1.46
TPSA125.65 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.23
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen?
The IUPAC name of 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen (CID 86744557) is 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen.
What is the SMILES notation for 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen?
The canonical SMILES for 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen is N#N.Nc1nccc(Cc2ccco2)c1N.
What is the InChIKey of 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen?
The InChIKey is RWFNBAJLHCQSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.N2/c11-9-7(3-4-13-10(9)12)6-8-2-1-5-14-8;1-2/h1-5H,6,11H2,(H2,12,13);.
What are the key properties of 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen?
4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen has a molecular weight of 217.23 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-ylmethyl)pyridine-2,3-diamine;molecular nitrogen is sourced from PubChem (CID 86744557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).