About 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone
2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone (PubChem CID 96629973) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone.
Analyze 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone?
The IUPAC name of 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone (CID 96629973) is 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone.
What is the SMILES notation for 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone?
The canonical SMILES for 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone is NCC(=O)c1nc2cccnc2o1.
What is the InChIKey of 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone?
The InChIKey is WADBTMLXAORDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-4-6(12)8-11-5-2-1-3-10-7(5)13-8/h1-3H,4,9H2.
What are the key properties of 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone?
2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone has a molecular weight of 177.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-([1,3]oxazolo[5,4-b]pyridin-2-yl)ethanone is sourced from PubChem (CID 96629973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).