About 1-oxaspiro[5.6]dodecane
1-oxaspiro[5.6]dodecane (PubChem CID 96632218) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-oxaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 1-oxaspiro[5.6]dodecane |
| PubChem CID | 96632218 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-oxaspiro[5.6]dodecane |
| SMILES | C1CCCC2(CC1)CCCCO2 |
| InChI | InChI=1S/C11H20O/c1-2-4-8-11(7-3-1)9-5-6-10-12-11/h1-10H2 |
| InChIKey | MLMTXCWWZGURTD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-oxaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[5.6]dodecane?
The IUPAC name of 1-oxaspiro[5.6]dodecane (CID 96632218) is 1-oxaspiro[5.6]dodecane.
What is the SMILES notation for 1-oxaspiro[5.6]dodecane?
The canonical SMILES for 1-oxaspiro[5.6]dodecane is C1CCCC2(CC1)CCCCO2.
What is the InChIKey of 1-oxaspiro[5.6]dodecane?
The InChIKey is MLMTXCWWZGURTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-2-4-8-11(7-3-1)9-5-6-10-12-11/h1-10H2.
What are the key properties of 1-oxaspiro[5.6]dodecane?
1-oxaspiro[5.6]dodecane has a molecular weight of 168.28 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[5.6]dodecane is sourced from PubChem (CID 96632218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).