C7H4N2O3 — CID 96633688
4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde (PubChem CID 96633688) has the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. Its IUPAC name is 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde.
| Compound Name | 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde |
|---|---|
| PubChem CID | 96633688 |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde |
| SMILES | O=Cc1nonc1-c1ccco1 |
| InChI | InChI=1S/C7H4N2O3/c10-4-5-7(9-12-8-5)6-2-1-3-11-6/h1-4H |
| InChIKey | VJKLZEGUXMNAJX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|