About 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde
4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde (PubChem CID 96633688) has the molecular formula C7H4N2O3
and a molecular weight of 164.12 g/mol. Its IUPAC name is 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde |
| PubChem CID | 96633688 |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde |
| SMILES | O=Cc1nonc1-c1ccco1 |
| InChI | InChI=1S/C7H4N2O3/c10-4-5-7(9-12-8-5)6-2-1-3-11-6/h1-4H |
| InChIKey | VJKLZEGUXMNAJX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde?
The IUPAC name of 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde (CID 96633688) is 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde.
What is the SMILES notation for 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde?
The canonical SMILES for 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde is O=Cc1nonc1-c1ccco1.
What is the InChIKey of 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde?
The InChIKey is VJKLZEGUXMNAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3/c10-4-5-7(9-12-8-5)6-2-1-3-11-6/h1-4H.
What are the key properties of 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde?
4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde has a molecular weight of 164.12 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-1,2,5-oxadiazole-3-carbaldehyde is sourced from PubChem (CID 96633688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).