C10H5NO4 — CID 82396986
2-(furan-2-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde (PubChem CID 82396986) has the molecular formula C10H5NO4 and a molecular weight of 203.15 g/mol. Its IUPAC name is 2-(furan-2-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde.
| Compound Name | 2-(furan-2-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde |
|---|---|
| PubChem CID | 82396986 |
| Molecular Formula | C10H5NO4 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2-(furan-2-yl)furo[3,4-d][1,3]oxazole-6-carbaldehyde |
| SMILES | O=Cc1occ2nc(-c3ccco3)oc12 |
| InChI | InChI=1S/C10H5NO4/c12-4-8-9-6(5-14-8)11-10(15-9)7-2-1-3-13-7/h1-5H |
| InChIKey | BDFOLSNFRUVOAY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|