C11H5BrFNO2 — CID 82095537
7-bromo-5-fluoro-2-(furan-2-yl)-1,3-benzoxazole (PubChem CID 82095537) has the molecular formula C11H5BrFNO2 and a molecular weight of 282.07 g/mol. Its IUPAC name is 7-bromo-5-fluoro-2-(furan-2-yl)-1,3-benzoxazole.
| Compound Name | 7-bromo-5-fluoro-2-(furan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 82095537 |
| Molecular Formula | C11H5BrFNO2 |
| Molecular Weight | 282.07 g/mol |
| Exact Mass | 280.95 |
| IUPAC Name | 7-bromo-5-fluoro-2-(furan-2-yl)-1,3-benzoxazole |
| SMILES | Fc1cc(Br)c2oc(-c3ccco3)nc2c1 |
| InChI | InChI=1S/C11H5BrFNO2/c12-7-4-6(13)5-8-10(7)16-11(14-8)9-2-1-3-15-9/h1-5H |
| InChIKey | RFOBJGASQREKER-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |