About 7-fluoroindol-1-amine
7-fluoroindol-1-amine (PubChem CID 96636191) has the molecular formula C8H7FN2
and a molecular weight of 150.16 g/mol. Its IUPAC name is 7-fluoroindol-1-amine.
Molecular Properties
| Compound Name | 7-fluoroindol-1-amine |
| PubChem CID | 96636191 |
| Molecular Formula | C8H7FN2 |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.06 |
| IUPAC Name | 7-fluoroindol-1-amine |
| SMILES | Nn1ccc2cccc(F)c21 |
| InChI | InChI=1S/C8H7FN2/c9-7-3-1-2-6-4-5-11(10)8(6)7/h1-5H,10H2 |
| InChIKey | BDRLZRSTHANWGH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoroindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoroindol-1-amine?
The IUPAC name of 7-fluoroindol-1-amine (CID 96636191) is 7-fluoroindol-1-amine.
What is the SMILES notation for 7-fluoroindol-1-amine?
The canonical SMILES for 7-fluoroindol-1-amine is Nn1ccc2cccc(F)c21.
What is the InChIKey of 7-fluoroindol-1-amine?
The InChIKey is BDRLZRSTHANWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2/c9-7-3-1-2-6-4-5-11(10)8(6)7/h1-5H,10H2.
What are the key properties of 7-fluoroindol-1-amine?
7-fluoroindol-1-amine has a molecular weight of 150.16 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoroindol-1-amine is sourced from PubChem (CID 96636191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).