C13H17N3O3 — CID 96666406
[3-(2,4,6-trimethoxyphenyl)-1H-pyrazol-5-yl]methanamine (PubChem CID 96666406) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [3-(2,4,6-trimethoxyphenyl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | [3-(2,4,6-trimethoxyphenyl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 96666406 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [3-(2,4,6-trimethoxyphenyl)-1H-pyrazol-5-yl]methanamine |
| SMILES | COc1cc(OC)c(-c2cc(CN)[nH]n2)c(OC)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-17-9-5-11(18-2)13(12(6-9)19-3)10-4-8(7-14)15-16-10/h4-6H,7,14H2,1-3H3,(H,15,16) |
| InChIKey | MFNQXLFVSJGORC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |