C18H26N2 — CID 96679133
[1-(1,2,4,7-tetramethylindol-3-yl)cyclopentyl]methanamine (PubChem CID 96679133) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is [1-(1,2,4,7-tetramethylindol-3-yl)cyclopentyl]methanamine.
| Compound Name | [1-(1,2,4,7-tetramethylindol-3-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 96679133 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | [1-(1,2,4,7-tetramethylindol-3-yl)cyclopentyl]methanamine |
| SMILES | Cc1ccc(C)c2c1c(C1(CN)CCCC1)c(C)n2C |
| InChI | InChI=1S/C18H26N2/c1-12-7-8-13(2)17-15(12)16(14(3)20(17)4)18(11-19)9-5-6-10-18/h7-8H,5-6,9-11,19H2,1-4H3 |
| InChIKey | BCMQCBKGTPCZTD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |