C15H19ClN2 — CID 82666568
[1-(5-chloro-1,2-dimethylindol-3-yl)cyclobutyl]methanamine (PubChem CID 82666568) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is [1-(5-chloro-1,2-dimethylindol-3-yl)cyclobutyl]methanamine.
| Compound Name | [1-(5-chloro-1,2-dimethylindol-3-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 82666568 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [1-(5-chloro-1,2-dimethylindol-3-yl)cyclobutyl]methanamine |
| SMILES | Cc1c(C2(CN)CCC2)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C15H19ClN2/c1-10-14(15(9-17)6-3-7-15)12-8-11(16)4-5-13(12)18(10)2/h4-5,8H,3,6-7,9,17H2,1-2H3 |
| InChIKey | JYBPTBYTXCWKLF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |