C7H11N3S — CID 96739341
[1-(1,2,4-thiadiazol-5-yl)cyclobutyl]methanamine (PubChem CID 96739341) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is [1-(1,2,4-thiadiazol-5-yl)cyclobutyl]methanamine.
| Compound Name | [1-(1,2,4-thiadiazol-5-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 96739341 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | [1-(1,2,4-thiadiazol-5-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2ncns2)CCC1 |
| InChI | InChI=1S/C7H11N3S/c8-4-7(2-1-3-7)6-9-5-10-11-6/h5H,1-4,8H2 |
| InChIKey | ZFHJPZOUVSCHQF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |