C9H15N3S — CID 96759338
4,5-dimethyl-3-piperazin-1-yl-1,2-thiazole (PubChem CID 96759338) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 4,5-dimethyl-3-piperazin-1-yl-1,2-thiazole.
| Compound Name | 4,5-dimethyl-3-piperazin-1-yl-1,2-thiazole |
|---|---|
| PubChem CID | 96759338 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4,5-dimethyl-3-piperazin-1-yl-1,2-thiazole |
| SMILES | Cc1snc(N2CCNCC2)c1C |
| InChI | InChI=1S/C9H15N3S/c1-7-8(2)13-11-9(7)12-5-3-10-4-6-12/h10H,3-6H2,1-2H3 |
| InChIKey | AKEPFVRENVDFLK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |