C12H12ClNO2 — CID 96820552
(2R)-3-(5-chloro-1H-indol-2-yl)-2-methylpropanoic acid (PubChem CID 96820552) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (2R)-3-(5-chloro-1H-indol-2-yl)-2-methylpropanoic acid.
| Compound Name | (2R)-3-(5-chloro-1H-indol-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 96820552 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (2R)-3-(5-chloro-1H-indol-2-yl)-2-methylpropanoic acid |
| SMILES | C[C@H](Cc1cc2cc(Cl)ccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C12H12ClNO2/c1-7(12(15)16)4-10-6-8-5-9(13)2-3-11(8)14-10/h2-3,5-7,14H,4H2,1H3,(H,15,16)/t7-/m1/s1 |
| InChIKey | BNUHXWZJZWKBBZ-SSDOTTSWSA-N |
| XLogP | 3.08 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |