C11H19N3O — CID 96864783
2-tert-butyl-5-[(2S)-piperidin-2-yl]-1,3,4-oxadiazole (PubChem CID 96864783) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-tert-butyl-5-[(2S)-piperidin-2-yl]-1,3,4-oxadiazole.
| Compound Name | 2-tert-butyl-5-[(2S)-piperidin-2-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 96864783 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-tert-butyl-5-[(2S)-piperidin-2-yl]-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1nnc([C@@H]2CCCCN2)o1 |
| InChI | InChI=1S/C11H19N3O/c1-11(2,3)10-14-13-9(15-10)8-6-4-5-7-12-8/h8,12H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | FRMHPPFYNMGWHC-QMMMGPOBSA-N |
| XLogP | 2.18 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |