C12H18N2O — CID 83859417
2-piperidin-2-yl-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 83859417) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-piperidin-2-yl-4,5,6,7-tetrahydro-1,3-benzoxazole.
| Compound Name | 2-piperidin-2-yl-4,5,6,7-tetrahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 83859417 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-piperidin-2-yl-4,5,6,7-tetrahydro-1,3-benzoxazole |
| SMILES | C1CCC(c2nc3c(o2)CCCC3)NC1 |
| InChI | InChI=1S/C12H18N2O/c1-2-7-11-9(5-1)14-12(15-11)10-6-3-4-8-13-10/h10,13H,1-8H2 |
| InChIKey | RZUUKJBGCYNTGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |