C10H16N4O — CID 110456032
N-cyclopropyl-5-piperidin-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 110456032) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is N-cyclopropyl-5-piperidin-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-cyclopropyl-5-piperidin-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110456032 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N-cyclopropyl-5-piperidin-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | C1CCC(c2nnc(NC3CC3)o2)NC1 |
| InChI | InChI=1S/C10H16N4O/c1-2-6-11-8(3-1)9-13-14-10(15-9)12-7-4-5-7/h7-8,11H,1-6H2,(H,12,14) |
| InChIKey | REIZEMDJNMSDIS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |