C9H13N3O — CID 83875168
5-cyclobutyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine (PubChem CID 83875168) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-cyclobutyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-cyclobutyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 83875168 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-cyclobutyl-N-cyclopropyl-1,3,4-oxadiazol-2-amine |
| SMILES | C1CC(c2nnc(NC3CC3)o2)C1 |
| InChI | InChI=1S/C9H13N3O/c1-2-6(3-1)8-11-12-9(13-8)10-7-4-5-7/h6-7H,1-5H2,(H,10,12) |
| InChIKey | XLOQPDXLZCLFOC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |