C5H7N3OS2 — CID 123387677
N-cyclopropyl-5-(disulfanyl)-1,3,4-oxadiazol-2-amine (PubChem CID 123387677) has the molecular formula C5H7N3OS2 and a molecular weight of 189.26 g/mol. Its IUPAC name is N-cyclopropyl-5-(disulfanyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-cyclopropyl-5-(disulfanyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 123387677 |
| Molecular Formula | C5H7N3OS2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | N-cyclopropyl-5-(disulfanyl)-1,3,4-oxadiazol-2-amine |
| SMILES | SSc1nnc(NC2CC2)o1 |
| InChI | InChI=1S/C5H7N3OS2/c10-11-5-8-7-4(9-5)6-3-1-2-3/h3,10H,1-2H2,(H,6,7) |
| InChIKey | MGICTIZHECVIRJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|