C12H17N3O — CID 138115367
N-[(1S)-cyclohept-3-en-1-yl]-5-cyclopropyl-1,3,4-oxadiazol-2-amine (PubChem CID 138115367) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-[(1S)-cyclohept-3-en-1-yl]-5-cyclopropyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[(1S)-cyclohept-3-en-1-yl]-5-cyclopropyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 138115367 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-[(1S)-cyclohept-3-en-1-yl]-5-cyclopropyl-1,3,4-oxadiazol-2-amine |
| SMILES | C1=CC[C@@H](Nc2nnc(C3CC3)o2)CCC1 |
| InChI | InChI=1S/C12H17N3O/c1-2-4-6-10(5-3-1)13-12-15-14-11(16-12)9-7-8-9/h1,3,9-10H,2,4-8H2,(H,13,15)/t10-/m1/s1 |
| InChIKey | DPPNDLLJMAKYRD-SNVBAGLBSA-N |
| XLogP | 2.86 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|