C17H18N4O2S — CID 96996408
6-ethyl-N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 96996408) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-ethyl-N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 96996408 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-ethyl-N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(N(C)[C@@H](C)c3cccc([N+](=O)[O-])c3)ncnc2s1 |
| InChI | InChI=1S/C17H18N4O2S/c1-4-14-9-15-16(18-10-19-17(15)24-14)20(3)11(2)12-6-5-7-13(8-12)21(22)23/h5-11H,4H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZIRIBWAGRJZTFK-NSHDSACASA-N |
| XLogP | 4.36 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|