C19H19N5O2 — CID 96998919
(2R)-N-methyl-2-phenyl-2-[[2-(5-pyridin-4-ylpyrazol-1-yl)acetyl]amino]acetamide (PubChem CID 96998919) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2R)-N-methyl-2-phenyl-2-[[2-(5-pyridin-4-ylpyrazol-1-yl)acetyl]amino]acetamide.
| Compound Name | (2R)-N-methyl-2-phenyl-2-[[2-(5-pyridin-4-ylpyrazol-1-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 96998919 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (2R)-N-methyl-2-phenyl-2-[[2-(5-pyridin-4-ylpyrazol-1-yl)acetyl]amino]acetamide |
| SMILES | CNC(=O)[C@H](NC(=O)Cn1nccc1-c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C19H19N5O2/c1-20-19(26)18(15-5-3-2-4-6-15)23-17(25)13-24-16(9-12-22-24)14-7-10-21-11-8-14/h2-12,18H,13H2,1H3,(H,20,26)(H,23,25)/t18-/m1/s1 |
| InChIKey | WNOPSNWFKOOVLH-GOSISDBHSA-N |
| XLogP | 1.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |