C15H21NO2 — CID 97003578
N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-N,3,5-trimethylbenzamide (PubChem CID 97003578) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-N,3,5-trimethylbenzamide.
| Compound Name | N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-N,3,5-trimethylbenzamide |
|---|---|
| PubChem CID | 97003578 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-N,3,5-trimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(C)C[C@@H](O)C2CC2)c1 |
| InChI | InChI=1S/C15H21NO2/c1-10-6-11(2)8-13(7-10)15(18)16(3)9-14(17)12-4-5-12/h6-8,12,14,17H,4-5,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | ZIYSKIOVSSUGMA-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |