C21H27N3O6S — CID 97003623
(3R)-N-(3,5-dimethoxyphenyl)-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidin-3-amine (PubChem CID 97003623) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is (3R)-N-(3,5-dimethoxyphenyl)-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidin-3-amine.
| Compound Name | (3R)-N-(3,5-dimethoxyphenyl)-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 97003623 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3R)-N-(3,5-dimethoxyphenyl)-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidin-3-amine |
| SMILES | COc1cc(N[C@@H]2CCCN(S(=O)(=O)c3cc([N+](=O)[O-])cc(C)c3C)C2)cc(OC)c1 |
| InChI | InChI=1S/C21H27N3O6S/c1-14-8-18(24(25)26)11-21(15(14)2)31(27,28)23-7-5-6-16(13-23)22-17-9-19(29-3)12-20(10-17)30-4/h8-12,16,22H,5-7,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | HXFGNFVUQXMCGJ-MRXNPFEDSA-N |
| XLogP | 3.49 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|