C19H28N4O5S — CID 35398892
N-cyclohexyl-4-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 35398892) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 35398892 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-cyclohexyl-4-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(C(=O)NC3CCCCC3)CC2)c1C |
| InChI | InChI=1S/C19H28N4O5S/c1-14-12-17(23(25)26)13-18(15(14)2)29(27,28)22-10-8-21(9-11-22)19(24)20-16-6-4-3-5-7-16/h12-13,16H,3-11H2,1-2H3,(H,20,24) |
| InChIKey | QEAFJEZUNSYUBN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|