C14H20N2O5S — CID 97003937
N-[(1R,2S)-2-(hydroxymethyl)-2-methylcyclopentyl]-2-methyl-4-nitrobenzenesulfonamide (PubChem CID 97003937) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[(1R,2S)-2-(hydroxymethyl)-2-methylcyclopentyl]-2-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2S)-2-(hydroxymethyl)-2-methylcyclopentyl]-2-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 97003937 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[(1R,2S)-2-(hydroxymethyl)-2-methylcyclopentyl]-2-methyl-4-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)N[C@@H]1CCC[C@]1(C)CO |
| InChI | InChI=1S/C14H20N2O5S/c1-10-8-11(16(18)19)5-6-12(10)22(20,21)15-13-4-3-7-14(13,2)9-17/h5-6,8,13,15,17H,3-4,7,9H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | QGKIQRJQIRRWDZ-ZIAGYGMSSA-N |
| XLogP | 1.73 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|