C14H21NO3 — CID 97005253
3,3-dicyclopropyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]prop-2-enamide (PubChem CID 97005253) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]prop-2-enamide.
| Compound Name | 3,3-dicyclopropyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 97005253 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3,3-dicyclopropyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(C=C(C1CC1)C1CC1)NC[C@H]1COCCO1 |
| InChI | InChI=1S/C14H21NO3/c16-14(15-8-12-9-17-5-6-18-12)7-13(10-1-2-10)11-3-4-11/h7,10-12H,1-6,8-9H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | WVWBCSBPSHLPCG-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|