C16H29NO3 — CID 123958722
N-(1,4-dioxan-2-ylmethyl)-3,5-dimethylnon-2-enamide (PubChem CID 123958722) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3,5-dimethylnon-2-enamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3,5-dimethylnon-2-enamide |
|---|---|
| PubChem CID | 123958722 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3,5-dimethylnon-2-enamide |
| SMILES | CCCCC(C)CC(C)=CC(=O)NCC1COCCO1 |
| InChI | InChI=1S/C16H29NO3/c1-4-5-6-13(2)9-14(3)10-16(18)17-11-15-12-19-7-8-20-15/h10,13,15H,4-9,11-12H2,1-3H3,(H,17,18) |
| InChIKey | KHOPBMNYEJQQCQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|